C14H22ClFN2O3S — CID 120718980
[1-(5-fluoro-2-methylphenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride (PubChem CID 120718980) has the molecular formula C14H22ClFN2O3S and a molecular weight of 352.86 g/mol. Its IUPAC name is [1-(5-fluoro-2-methylphenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(5-fluoro-2-methylphenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120718980 |
| Molecular Formula | C14H22ClFN2O3S |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [1-(5-fluoro-2-methylphenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride |
| SMILES | COC1CCN(S(=O)(=O)c2cc(F)ccc2C)C(CN)C1.Cl |
| InChI | InChI=1S/C14H21FN2O3S.ClH/c1-10-3-4-11(15)7-14(10)21(18,19)17-6-5-13(20-2)8-12(17)9-16;/h3-4,7,12-13H,5-6,8-9,16H2,1-2H3;1H |
| InChIKey | ADRNVQUKGSSHLN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |