C16H18FNO4S — CID 97239642
(1S)-2-[(2R)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-(furan-2-yl)ethanol (PubChem CID 97239642) has the molecular formula C16H18FNO4S and a molecular weight of 339.39 g/mol. Its IUPAC name is (1S)-2-[(2R)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-(furan-2-yl)ethanol.
| Compound Name | (1S)-2-[(2R)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 97239642 |
| Molecular Formula | C16H18FNO4S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (1S)-2-[(2R)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-(furan-2-yl)ethanol |
| SMILES | O=S(=O)(c1ccccc1F)N1CCC[C@@H]1C[C@H](O)c1ccco1 |
| InChI | InChI=1S/C16H18FNO4S/c17-13-6-1-2-8-16(13)23(20,21)18-9-3-5-12(18)11-14(19)15-7-4-10-22-15/h1-2,4,6-8,10,12,14,19H,3,5,9,11H2/t12-,14+/m1/s1 |
| InChIKey | WEJSZMFDVGWSRY-OCCSQVGLSA-N |
| XLogP | 2.70 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |