C27H34N2O5S — CID 55417675
[1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 55417675) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is [1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55417675 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [1-(4-benzylpiperidin-1-yl)-1-oxopropan-2-yl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H34N2O5S/c1-21(26(30)28-17-13-23(14-18-28)19-22-9-4-2-5-10-22)34-27(31)24-11-8-12-25(20-24)35(32,33)29-15-6-3-7-16-29/h2,4-5,8-12,20-21,23H,3,6-7,13-19H2,1H3 |
| InChIKey | QKSURJCNZGCMEH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |