C26H28N4O4S — CID 90448930
4-(1,3-dihydroisoindol-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)benzohydrazide (PubChem CID 90448930) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindol-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)benzohydrazide.
| Compound Name | 4-(1,3-dihydroisoindol-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)benzohydrazide |
|---|---|
| PubChem CID | 90448930 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-(1,3-dihydroisoindol-2-ylmethyl)-N-(4-morpholin-4-ylsulfonylphenyl)benzohydrazide |
| SMILES | NN(C(=O)c1ccc(CN2Cc3ccccc3C2)cc1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H28N4O4S/c27-30(24-9-11-25(12-10-24)35(32,33)29-13-15-34-16-14-29)26(31)21-7-5-20(6-8-21)17-28-18-22-3-1-2-4-23(22)19-28/h1-12H,13-19,27H2 |
| InChIKey | GCVUKLGKXCACBO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|