C16H24FN3O3S — CID 170319766
3-fluoro-1-[(4-morpholin-4-ylsulfonylphenyl)methyl]piperidin-3-amine (PubChem CID 170319766) has the molecular formula C16H24FN3O3S and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-fluoro-1-[(4-morpholin-4-ylsulfonylphenyl)methyl]piperidin-3-amine.
| Compound Name | 3-fluoro-1-[(4-morpholin-4-ylsulfonylphenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 170319766 |
| Molecular Formula | C16H24FN3O3S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-fluoro-1-[(4-morpholin-4-ylsulfonylphenyl)methyl]piperidin-3-amine |
| SMILES | NC1(F)CCCN(Cc2ccc(S(=O)(=O)N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C16H24FN3O3S/c17-16(18)6-1-7-19(13-16)12-14-2-4-15(5-3-14)24(21,22)20-8-10-23-11-9-20/h2-5H,1,6-13,18H2 |
| InChIKey | IHLMVGHJVHNNCC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|