About 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine
1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine (PubChem CID 87821713) has the molecular formula C19H27N3O2
and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine.
Molecular Properties
| Compound Name | 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine |
| PubChem CID | 87821713 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine |
| SMILES | O=C1CCN(Cc2ccccc2)CC1.[C-]#[N+]CCN1CCOCC1 |
| InChI | InChI=1S/C12H15NO.C7H12N2O/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;1-8-2-3-9-4-6-10-7-5-9/h1-5H,6-10H2;2-7H2 |
| InChIKey | NAMUSEIAQNDZBZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine?
The IUPAC name of 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine (CID 87821713) is 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine.
What is the SMILES notation for 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine?
The canonical SMILES for 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine is O=C1CCN(Cc2ccccc2)CC1.[C-]#[N+]CCN1CCOCC1.
What is the InChIKey of 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine?
The InChIKey is NAMUSEIAQNDZBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.C7H12N2O/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;1-8-2-3-9-4-6-10-7-5-9/h1-5H,6-10H2;2-7H2.
What are the key properties of 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine?
1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine has a molecular weight of 329.44 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpiperidin-4-one;4-(2-isocyanoethyl)morpholine is sourced from PubChem (CID 87821713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).