C20H31N3O3 — CID 77093940
1-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-1,4-diazepan-5-one (PubChem CID 77093940) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-1,4-diazepan-5-one.
| Compound Name | 1-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 77093940 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 1-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(Cc2cccc(OCCCCN3CCOCC3)c2)CCN1 |
| InChI | InChI=1S/C20H31N3O3/c24-20-6-9-23(10-7-21-20)17-18-4-3-5-19(16-18)26-13-2-1-8-22-11-14-25-15-12-22/h3-5,16H,1-2,6-15,17H2,(H,21,24) |
| InChIKey | SKWKPUKZDGTAKU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|