C24H38N2O7 — CID 154921317
(3aS,6aR)-2-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid (PubChem CID 154921317) has the molecular formula C24H38N2O7 and a molecular weight of 466.58 g/mol. Its IUPAC name is (3aS,6aR)-2-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid.
| Compound Name | (3aS,6aR)-2-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid |
|---|---|
| PubChem CID | 154921317 |
| Molecular Formula | C24H38N2O7 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (3aS,6aR)-2-[[3-(4-morpholin-4-ylbutoxy)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid |
| SMILES | O=CO.O=CO.OC1C[C@@H]2CN(Cc3cccc(OCCCCN4CCOCC4)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H34N2O3.2CH2O2/c25-21-13-19-16-24(17-20(19)14-21)15-18-4-3-5-22(12-18)27-9-2-1-6-23-7-10-26-11-8-23;2*2-1-3/h3-5,12,19-21,25H,1-2,6-11,13-17H2;2*1H,(H,2,3)/t19-,20+,21?;; |
| InChIKey | VKKRWMFTPHZZEC-PZLSKONFSA-N |
| XLogP | 1.78 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|