C22H35N3O2 — CID 99926332
4-[2-[3-[[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]phenoxy]ethyl]morpholine (PubChem CID 99926332) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-[2-[3-[[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]phenoxy]ethyl]morpholine.
| Compound Name | 4-[2-[3-[[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 99926332 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 4-[2-[3-[[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]phenoxy]ethyl]morpholine |
| SMILES | c1cc(CN2CC[C@H](N3CCCCC3)C2)cc(OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H35N3O2/c1-2-8-25(9-3-1)21-7-10-24(19-21)18-20-5-4-6-22(17-20)27-16-13-23-11-14-26-15-12-23/h4-6,17,21H,1-3,7-16,18-19H2/t21-/m0/s1 |
| InChIKey | XQIRYDVVWXXITN-NRFANRHFSA-N |
| XLogP | 2.46 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |