C22H35N3O2 — CID 99928489
4-[3-[3-[[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methyl]phenoxy]propyl]morpholine (PubChem CID 99928489) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-[3-[3-[[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methyl]phenoxy]propyl]morpholine.
| Compound Name | 4-[3-[3-[[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methyl]phenoxy]propyl]morpholine |
|---|---|
| PubChem CID | 99928489 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 4-[3-[3-[[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]methyl]phenoxy]propyl]morpholine |
| SMILES | c1cc(CN2CCN3CCCC[C@@H]3C2)cc(OCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H35N3O2/c1-2-9-25-11-10-24(19-21(25)6-1)18-20-5-3-7-22(17-20)27-14-4-8-23-12-15-26-16-13-23/h3,5,7,17,21H,1-2,4,6,8-16,18-19H2/t21-/m1/s1 |
| InChIKey | RTGROBDWYYWBBZ-OAQYLSRUSA-N |
| XLogP | 2.46 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|