C13H17NO3 — CID 54183396
2-[3-(morpholin-4-ylmethyl)phenoxy]acetaldehyde (PubChem CID 54183396) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[3-(morpholin-4-ylmethyl)phenoxy]acetaldehyde.
| Compound Name | 2-[3-(morpholin-4-ylmethyl)phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 54183396 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[3-(morpholin-4-ylmethyl)phenoxy]acetaldehyde |
| SMILES | O=CCOc1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C13H17NO3/c15-6-9-17-13-3-1-2-12(10-13)11-14-4-7-16-8-5-14/h1-3,6,10H,4-5,7-9,11H2 |
| InChIKey | DSEBQEGTCHOYLC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|