C23H31N5O3 — CID 131942057
2-[4-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 131942057) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[4-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 131942057 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-[4-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCN(Cc2cccc(OCCN3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C23H31N5O3/c24-22(29)21-5-2-6-25-23(21)28-9-7-27(8-10-28)18-19-3-1-4-20(17-19)31-16-13-26-11-14-30-15-12-26/h1-6,17H,7-16,18H2,(H2,24,29) |
| InChIKey | UGXMNXFIKISFNA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |