C17H29N2O2P — CID 12067689
3-[3-cyclopenta-1,3-dien-1-ylpropoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 12067689) has the molecular formula C17H29N2O2P and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[3-cyclopenta-1,3-dien-1-ylpropoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[3-cyclopenta-1,3-dien-1-ylpropoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 12067689 |
| Molecular Formula | C17H29N2O2P |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-[3-cyclopenta-1,3-dien-1-ylpropoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCCC1=CC=CC1 |
| InChI | InChI=1S/C17H29N2O2P/c1-15(2)19(16(3)4)22(21-14-8-12-18)20-13-7-11-17-9-5-6-10-17/h5-6,9,15-16H,7-8,10-11,13-14H2,1-4H3 |
| InChIKey | MNAFZHLKIBLZBL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|