C29H30O3 — CID 12067687
1-[3-cyclopenta-1,3-dien-1-ylpropoxy-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene (PubChem CID 12067687) has the molecular formula C29H30O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-[3-cyclopenta-1,3-dien-1-ylpropoxy-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene.
| Compound Name | 1-[3-cyclopenta-1,3-dien-1-ylpropoxy-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 12067687 |
| Molecular Formula | C29H30O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[3-cyclopenta-1,3-dien-1-ylpropoxy-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene |
| SMILES | COc1ccc(C(OCCCC2=CC=CC2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H30O3/c1-30-27-18-14-25(15-19-27)29(24-12-4-3-5-13-24,26-16-20-28(31-2)21-17-26)32-22-8-11-23-9-6-7-10-23/h3-7,9,12-21H,8,10-11,22H2,1-2H3 |
| InChIKey | UBCAWUCWLKMMJH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|