C28H29BrN2O6 — CID 164621364
3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxymethyl]-5-bromo-6-hydroxy-1,6-dihydropyrimidin-2-one (PubChem CID 164621364) has the molecular formula C28H29BrN2O6 and a molecular weight of 569.45 g/mol. Its IUPAC name is 3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxymethyl]-5-bromo-6-hydroxy-1,6-dihydropyrimidin-2-one.
| Compound Name | 3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxymethyl]-5-bromo-6-hydroxy-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 164621364 |
| Molecular Formula | C28H29BrN2O6 |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxymethyl]-5-bromo-6-hydroxy-1,6-dihydropyrimidin-2-one |
| SMILES | COc1ccc(C(OCCOCN2C=C(Br)C(O)NC2=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H29BrN2O6/c1-34-23-12-8-21(9-13-23)28(20-6-4-3-5-7-20,22-10-14-24(35-2)15-11-22)37-17-16-36-19-31-18-25(29)26(32)30-27(31)33/h3-15,18,26,32H,16-17,19H2,1-2H3,(H,30,33) |
| InChIKey | SFWKQVPBYXKBAT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|