C42H50O4S — CID 135771688
S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(E)-3-phenylprop-2-enoxy]propan-2-yl] decanethioate (PubChem CID 135771688) has the molecular formula C42H50O4S and a molecular weight of 650.93 g/mol. Its IUPAC name is S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(E)-3-phenylprop-2-enoxy]propan-2-yl] decanethioate.
| Compound Name | S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(E)-3-phenylprop-2-enoxy]propan-2-yl] decanethioate |
|---|---|
| PubChem CID | 135771688 |
| Molecular Formula | C42H50O4S |
| Molecular Weight | 650.93 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(E)-3-phenylprop-2-enoxy]propan-2-yl] decanethioate |
| SMILES | CCCCCCCCCC(=O)S[C@@H](COC/C=C/c1ccccc1)COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C42H50O4S/c1-3-4-5-6-7-8-18-27-41(43)47-40(33-45-32-19-22-35-20-12-9-13-21-35)34-46-42(36-23-14-10-15-24-36,37-25-16-11-17-26-37)38-28-30-39(44-2)31-29-38/h9-17,19-26,28-31,40H,3-8,18,27,32-34H2,1-2H3/b22-19+/t40-/m0/s1 |
| InChIKey | TVRWGDWLXFPXKA-VKUYBBMKSA-N |
| XLogP | 10.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.93 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|