C35H38O6S — CID 10008518
[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] 4-methylbenzenesulfonate (PubChem CID 10008518) has the molecular formula C35H38O6S and a molecular weight of 586.75 g/mol. Its IUPAC name is [(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10008518 |
| Molecular Formula | C35H38O6S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | [(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CC/C=C\COC[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H38O6S/c1-4-5-12-25-39-26-33(41-42(36,37)34-23-17-28(2)18-24-34)27-40-35(29-13-8-6-9-14-29,30-15-10-7-11-16-30)31-19-21-32(38-3)22-20-31/h5-24,33H,4,25-27H2,1-3H3/b12-5-/t33-/m0/s1 |
| InChIKey | KBGFSUHSRXURRN-KYWPKCELSA-N |
| XLogP | 7.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|