C25H28O6S — CID 102214438
[(2R)-1-(4-methoxyphenoxy)-4-phenylmethoxybutan-2-yl] 4-methylbenzenesulfonate (PubChem CID 102214438) has the molecular formula C25H28O6S and a molecular weight of 456.56 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyphenoxy)-4-phenylmethoxybutan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-1-(4-methoxyphenoxy)-4-phenylmethoxybutan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102214438 |
| Molecular Formula | C25H28O6S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [(2R)-1-(4-methoxyphenoxy)-4-phenylmethoxybutan-2-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(OC[C@@H](CCOCc2ccccc2)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H28O6S/c1-20-8-14-25(15-9-20)32(26,27)31-24(16-17-29-18-21-6-4-3-5-7-21)19-30-23-12-10-22(28-2)11-13-23/h3-15,24H,16-19H2,1-2H3/t24-/m1/s1 |
| InChIKey | UTYSKNPJSDLCOO-XMMPIXPASA-N |
| XLogP | 4.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|