C27H31NO4S — CID 91071012
(4-cyano-4-phenyl-1-phenylmethoxybutan-2-yl) 4-methylbenzenesulfonate;ethane (PubChem CID 91071012) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is (4-cyano-4-phenyl-1-phenylmethoxybutan-2-yl) 4-methylbenzenesulfonate;ethane.
| Compound Name | (4-cyano-4-phenyl-1-phenylmethoxybutan-2-yl) 4-methylbenzenesulfonate;ethane |
|---|---|
| PubChem CID | 91071012 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (4-cyano-4-phenyl-1-phenylmethoxybutan-2-yl) 4-methylbenzenesulfonate;ethane |
| SMILES | CC.Cc1ccc(S(=O)(=O)OC(COCc2ccccc2)CC(C#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO4S.C2H6/c1-20-12-14-25(15-13-20)31(27,28)30-24(19-29-18-21-8-4-2-5-9-21)16-23(17-26)22-10-6-3-7-11-22;1-2/h2-15,23-24H,16,18-19H2,1H3;1-2H3 |
| InChIKey | KJLXOSOBUYQULM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|