C23H22BrLiO4S — CID 155415119
lithium [(2S)-1-(2-bromobenzene-6-id-1-yl)-3-phenylmethoxypropan-2-yl] 4-methylbenzenesulfonate (PubChem CID 155415119) has the molecular formula C23H22BrLiO4S and a molecular weight of 481.34 g/mol. Its IUPAC name is lithium [(2S)-1-(2-bromobenzene-6-id-1-yl)-3-phenylmethoxypropan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | lithium [(2S)-1-(2-bromobenzene-6-id-1-yl)-3-phenylmethoxypropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 155415119 |
| Molecular Formula | C23H22BrLiO4S |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | lithium [(2S)-1-(2-bromobenzene-6-id-1-yl)-3-phenylmethoxypropan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](COCc2ccccc2)Cc2[c-]cccc2Br)cc1.[Li+] |
| InChI | InChI=1S/C23H22BrO4S.Li/c1-18-11-13-22(14-12-18)29(25,26)28-21(15-20-9-5-6-10-23(20)24)17-27-16-19-7-3-2-4-8-19;/h2-8,10-14,21H,15-17H2,1H3;/q-1;+1/t21-;/m0./s1 |
| InChIKey | YQQRRNWFJSTIIA-BOXHHOBZSA-N |
| XLogP | 2.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|