C40H58O12S2 — CID 10795411
[(2S,4S,5S)-1-[4-[(2S,4S,5S)-4,5-dihydroxy-2-(4-methylphenyl)sulfonyloxydecoxy]phenoxy]-4,5-dihydroxydecan-2-yl] 4-methylbenzenesulfonate (PubChem CID 10795411) has the molecular formula C40H58O12S2 and a molecular weight of 795.03 g/mol. Its IUPAC name is [(2S,4S,5S)-1-[4-[(2S,4S,5S)-4,5-dihydroxy-2-(4-methylphenyl)sulfonyloxydecoxy]phenoxy]-4,5-dihydroxydecan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,4S,5S)-1-[4-[(2S,4S,5S)-4,5-dihydroxy-2-(4-methylphenyl)sulfonyloxydecoxy]phenoxy]-4,5-dihydroxydecan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10795411 |
| Molecular Formula | C40H58O12S2 |
| Molecular Weight | 795.03 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | [(2S,4S,5S)-1-[4-[(2S,4S,5S)-4,5-dihydroxy-2-(4-methylphenyl)sulfonyloxydecoxy]phenoxy]-4,5-dihydroxydecan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCC[C@H](O)[C@@H](O)C[C@@H](COc1ccc(OC[C@H](C[C@H](O)[C@@H](O)CCCCC)OS(=O)(=O)c2ccc(C)cc2)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C40H58O12S2/c1-5-7-9-11-37(41)39(43)25-33(51-53(45,46)35-21-13-29(3)14-22-35)27-49-31-17-19-32(20-18-31)50-28-34(26-40(44)38(42)12-10-8-6-2)52-54(47,48)36-23-15-30(4)16-24-36/h13-24,33-34,37-44H,5-12,25-28H2,1-4H3/t33-,34-,37-,38-,39-,40-/m0/s1 |
| InChIKey | YEKCTIUIXJLXAB-AFOVJSBPSA-N |
| XLogP | 5.99 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.03 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|