C31H29NO5S — CID 10918441
[(2R,3R)-3-cyano-2-hydroxy-4-trityloxybutyl] 4-methylbenzenesulfonate (PubChem CID 10918441) has the molecular formula C31H29NO5S and a molecular weight of 527.64 g/mol. Its IUPAC name is [(2R,3R)-3-cyano-2-hydroxy-4-trityloxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-3-cyano-2-hydroxy-4-trityloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10918441 |
| Molecular Formula | C31H29NO5S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [(2R,3R)-3-cyano-2-hydroxy-4-trityloxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)[C@H](C#N)COC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29NO5S/c1-24-17-19-29(20-18-24)38(34,35)37-23-30(33)25(21-32)22-36-31(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,25,30,33H,22-23H2,1H3/t25-,30+/m1/s1 |
| InChIKey | BBEXYJWHUCWPEQ-RNAHPLFWSA-N |
| XLogP | 5.21 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|