C35H38N2O7 — CID 18396864
[bis(4-methoxyphenyl)-phenylmethyl] N-(1,3-dihydroxypropan-2-yl)-3-(phenylmethoxycarbonylamino)propanimidate (PubChem CID 18396864) has the molecular formula C35H38N2O7 and a molecular weight of 598.70 g/mol. Its IUPAC name is [bis(4-methoxyphenyl)-phenylmethyl] N-(1,3-dihydroxypropan-2-yl)-3-(phenylmethoxycarbonylamino)propanimidate.
| Compound Name | [bis(4-methoxyphenyl)-phenylmethyl] N-(1,3-dihydroxypropan-2-yl)-3-(phenylmethoxycarbonylamino)propanimidate |
|---|---|
| PubChem CID | 18396864 |
| Molecular Formula | C35H38N2O7 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | [bis(4-methoxyphenyl)-phenylmethyl] N-(1,3-dihydroxypropan-2-yl)-3-(phenylmethoxycarbonylamino)propanimidate |
| SMILES | COc1ccc(C(O/C(CCNC(=O)OCc2ccccc2)=N/C(CO)CO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O7/c1-41-31-17-13-28(14-18-31)35(27-11-7-4-8-12-27,29-15-19-32(42-2)20-16-29)44-33(37-30(23-38)24-39)21-22-36-34(40)43-25-26-9-5-3-6-10-26/h3-20,30,38-39H,21-25H2,1-2H3,(H,36,40)/b37-33+ |
| InChIKey | GNCBXWPYQWPNCU-LAWMERGMSA-N |
| XLogP | 5.08 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|