C41H48N4O6 — CID 159786364
tert-butyl N-[(2S)-1-[[(3S)-2,5-dioxo-3-(phenylmethoxycarbonylamino)-5-(tritylamino)pentyl]amino]butan-2-yl]carbamate (PubChem CID 159786364) has the molecular formula C41H48N4O6 and a molecular weight of 692.86 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(3S)-2,5-dioxo-3-(phenylmethoxycarbonylamino)-5-(tritylamino)pentyl]amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(3S)-2,5-dioxo-3-(phenylmethoxycarbonylamino)-5-(tritylamino)pentyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 159786364 |
| Molecular Formula | C41H48N4O6 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(3S)-2,5-dioxo-3-(phenylmethoxycarbonylamino)-5-(tritylamino)pentyl]amino]butan-2-yl]carbamate |
| SMILES | CC[C@@H](CNCC(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H48N4O6/c1-5-34(43-39(49)51-40(2,3)4)27-42-28-36(46)35(44-38(48)50-29-30-18-10-6-11-19-30)26-37(47)45-41(31-20-12-7-13-21-31,32-22-14-8-15-23-32)33-24-16-9-17-25-33/h6-25,34-35,42H,5,26-29H2,1-4H3,(H,43,49)(H,44,48)(H,45,47)/t34-,35-/m0/s1 |
| InChIKey | OLHKCOGDUDVFQG-PXLJZGITSA-N |
| XLogP | 6.24 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|