C8H10ClN3O4 — CID 88941444
2-(chloroamino)oxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide (PubChem CID 88941444) has the molecular formula C8H10ClN3O4 and a molecular weight of 247.64 g/mol. Its IUPAC name is 2-(chloroamino)oxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide.
| Compound Name | 2-(chloroamino)oxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 88941444 |
| Molecular Formula | C8H10ClN3O4 |
| Molecular Weight | 247.64 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-(chloroamino)oxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide |
| SMILES | O=C(CONCl)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H10ClN3O4/c9-11-16-5-6(13)10-3-4-12-7(14)1-2-8(12)15/h1-2,11H,3-5H2,(H,10,13) |
| InChIKey | SKWITTKEUHIQGB-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.64 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|