C13H14N2O3Se — CID 166156326
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-selenophen-2-ylpropanamide (PubChem CID 166156326) has the molecular formula C13H14N2O3Se and a molecular weight of 325.23 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-selenophen-2-ylpropanamide.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-selenophen-2-ylpropanamide |
|---|---|
| PubChem CID | 166156326 |
| Molecular Formula | C13H14N2O3Se |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-selenophen-2-ylpropanamide |
| SMILES | O=C(CCc1ccc[se]1)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H14N2O3Se/c16-11(4-3-10-2-1-9-19-10)14-7-8-15-12(17)5-6-13(15)18/h1-2,5-6,9H,3-4,7-8H2,(H,14,16) |
| InChIKey | SEVWFGUQJBYFQY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|