C13H14N2O3SSe — CID 166156325
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-(thiaselenin-3-yl)propanamide (PubChem CID 166156325) has the molecular formula C13H14N2O3SSe and a molecular weight of 357.29 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-(thiaselenin-3-yl)propanamide.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-(thiaselenin-3-yl)propanamide |
|---|---|
| PubChem CID | 166156325 |
| Molecular Formula | C13H14N2O3SSe |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-(thiaselenin-3-yl)propanamide |
| SMILES | O=C(CCC1=CC=CS[Se]1)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H14N2O3SSe/c16-11(4-3-10-2-1-9-19-20-10)14-7-8-15-12(17)5-6-13(15)18/h1-2,5-6,9H,3-4,7-8H2,(H,14,16) |
| InChIKey | SCTIKMDWTDMYAA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|