C15H15N2O3- — CID 123560915
CID 123560915 (PubChem CID 123560915) has the molecular formula C15H15N2O3- and a molecular weight of 271.30 g/mol.
| Compound Name | CID 123560915 |
|---|---|
| PubChem CID | 123560915 |
| Molecular Formula | C15H15N2O3- |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | — |
| SMILES | [CH2-]c1ccc(CC(=O)NCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C15H15N2O3/c1-11-2-4-12(5-3-11)10-13(18)16-8-9-17-14(19)6-7-15(17)20/h2-7H,1,8-10H2,(H,16,18)/q-1 |
| InChIKey | LFIGAVALYGORFE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|