C6H8NO2P — CID 170722879
1-(2-phosphanylethyl)pyrrole-2,5-dione (PubChem CID 170722879) has the molecular formula C6H8NO2P and a molecular weight of 157.11 g/mol. Its IUPAC name is 1-(2-phosphanylethyl)pyrrole-2,5-dione.
| Compound Name | 1-(2-phosphanylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 170722879 |
| Molecular Formula | C6H8NO2P |
| Molecular Weight | 157.11 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 1-(2-phosphanylethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCP |
| InChI | InChI=1S/C6H8NO2P/c8-5-1-2-6(9)7(5)3-4-10/h1-2H,3-4,10H2 |
| InChIKey | ZIRXFDQEFNLQCL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.11 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|