C7H9NO2Sc-2 — CID 148988249
carbanide;1-ethylpyrrole-2,5-dione;scandium (PubChem CID 148988249) has the molecular formula C7H9NO2Sc-2 and a molecular weight of 184.11 g/mol. Its IUPAC name is carbanide;1-ethylpyrrole-2,5-dione;scandium.
| Compound Name | carbanide;1-ethylpyrrole-2,5-dione;scandium |
|---|---|
| PubChem CID | 148988249 |
| Molecular Formula | C7H9NO2Sc-2 |
| Molecular Weight | 184.11 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | carbanide;1-ethylpyrrole-2,5-dione;scandium |
| SMILES | [CH2-]CN1C(=O)C=CC1=O.[CH3-].[Sc] |
| InChI | InChI=1S/C6H6NO2.CH3.Sc/c1-2-7-5(8)3-4-6(7)9;;/h3-4H,1-2H2;1H3;/q2*-1; |
| InChIKey | KPMUUBYZHCTAMJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.11 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|