About carbanide;1-ethylpyrrole-2,5-dione;manganese(2+)
carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) (PubChem CID 59116237) has the molecular formula C7H9MnNO2
and a molecular weight of 194.09 g/mol. Its IUPAC name is carbanide;1-ethylpyrrole-2,5-dione;manganese(2+).
Molecular Properties
| Compound Name | carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) |
| PubChem CID | 59116237 |
| Molecular Formula | C7H9MnNO2 |
| Molecular Weight | 194.09 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) |
| SMILES | [CH2-]CN1C(=O)C=CC1=O.[CH3-].[Mn+2] |
| InChI | InChI=1S/C6H6NO2.CH3.Mn/c1-2-7-5(8)3-4-6(7)9;;/h3-4H,1-2H2;1H3;/q2*-1;+2 |
| InChIKey | VOEAEIQUZOKBIS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.09 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-ethylpyrrole-2,5-dione;manganese(2+)?
The IUPAC name of carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) (CID 59116237) is carbanide;1-ethylpyrrole-2,5-dione;manganese(2+).
What is the SMILES notation for carbanide;1-ethylpyrrole-2,5-dione;manganese(2+)?
The canonical SMILES for carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) is [CH2-]CN1C(=O)C=CC1=O.[CH3-].[Mn+2].
What is the InChIKey of carbanide;1-ethylpyrrole-2,5-dione;manganese(2+)?
The InChIKey is VOEAEIQUZOKBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6NO2.CH3.Mn/c1-2-7-5(8)3-4-6(7)9;;/h3-4H,1-2H2;1H3;/q2*-1;+2.
What are the key properties of carbanide;1-ethylpyrrole-2,5-dione;manganese(2+)?
carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) has a molecular weight of 194.09 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-ethylpyrrole-2,5-dione;manganese(2+) is sourced from PubChem (CID 59116237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).