C7H10N2O2 — CID 158008507
1-[2-(tritiomethylamino)ethyl]pyrrole-2,5-dione (PubChem CID 158008507) has the molecular formula C7H10N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 1-[2-(tritiomethylamino)ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(tritiomethylamino)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158008507 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 1-[2-(tritiomethylamino)ethyl]pyrrole-2,5-dione |
| SMILES | [3H]CNCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H10N2O2/c1-8-4-5-9-6(10)2-3-7(9)11/h2-3,8H,4-5H2,1H3/i1T |
| InChIKey | FEPCRJPVYFSZFH-CNRUNOGKSA-N |
| XLogP | -0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|