C9H12N2O4 — CID 90457244
3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoic acid (PubChem CID 90457244) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoic acid.
| Compound Name | 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 90457244 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-[2-(2,5-dioxopyrrol-1-yl)ethylamino]propanoic acid |
| SMILES | O=C(O)CCNCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H12N2O4/c12-7-1-2-8(13)11(7)6-5-10-4-3-9(14)15/h1-2,10H,3-6H2,(H,14,15) |
| InChIKey | FNCAHYWDWSEHDU-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|