2-chloro-3-oxoheptanoic acid

C7H11ClO3 — CID 23089387

IUPAC2-chloro-3-oxoheptanoic acid
SMILESCCCCC(=O)C(Cl)C(=O)O
InChIInChI=1S/C7H11ClO3/c1-2-3-4-5(9)6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11)
InChIKeyTVWKEDOTLCWCCC-UHFFFAOYSA-N
MW178.62 g/mol
LogP1.44
Rot. Bonds5

About 2-chloro-3-oxoheptanoic acid

2-chloro-3-oxoheptanoic acid (PubChem CID 23089387) has the molecular formula C7H11ClO3 and a molecular weight of 178.62 g/mol. Its IUPAC name is 2-chloro-3-oxoheptanoic acid.

Molecular Properties

Compound Name2-chloro-3-oxoheptanoic acid
PubChem CID23089387
Molecular FormulaC7H11ClO3
Molecular Weight178.62 g/mol
Exact Mass178.04
IUPAC Name2-chloro-3-oxoheptanoic acid
SMILESCCCCC(=O)C(Cl)C(=O)O
InChIInChI=1S/C7H11ClO3/c1-2-3-4-5(9)6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11)
InChIKeyTVWKEDOTLCWCCC-UHFFFAOYSA-N
XLogP1.44
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.62
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-chloro-3-oxoheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-3-oxoheptanoic acid?
The IUPAC name of 2-chloro-3-oxoheptanoic acid (CID 23089387) is 2-chloro-3-oxoheptanoic acid.
What is the SMILES notation for 2-chloro-3-oxoheptanoic acid?
The canonical SMILES for 2-chloro-3-oxoheptanoic acid is CCCCC(=O)C(Cl)C(=O)O.
What is the InChIKey of 2-chloro-3-oxoheptanoic acid?
The InChIKey is TVWKEDOTLCWCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO3/c1-2-3-4-5(9)6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11).
What are the key properties of 2-chloro-3-oxoheptanoic acid?
2-chloro-3-oxoheptanoic acid has a molecular weight of 178.62 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-oxoheptanoic acid is sourced from PubChem (CID 23089387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).