About 2-chloro-3-oxoheptanoic acid
2-chloro-3-oxoheptanoic acid (PubChem CID 23089387) has the molecular formula C7H11ClO3
and a molecular weight of 178.62 g/mol. Its IUPAC name is 2-chloro-3-oxoheptanoic acid.
Molecular Properties
| Compound Name | 2-chloro-3-oxoheptanoic acid |
| PubChem CID | 23089387 |
| Molecular Formula | C7H11ClO3 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 2-chloro-3-oxoheptanoic acid |
| SMILES | CCCCC(=O)C(Cl)C(=O)O |
| InChI | InChI=1S/C7H11ClO3/c1-2-3-4-5(9)6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11) |
| InChIKey | TVWKEDOTLCWCCC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-oxoheptanoic acid?
The IUPAC name of 2-chloro-3-oxoheptanoic acid (CID 23089387) is 2-chloro-3-oxoheptanoic acid.
What is the SMILES notation for 2-chloro-3-oxoheptanoic acid?
The canonical SMILES for 2-chloro-3-oxoheptanoic acid is CCCCC(=O)C(Cl)C(=O)O.
What is the InChIKey of 2-chloro-3-oxoheptanoic acid?
The InChIKey is TVWKEDOTLCWCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO3/c1-2-3-4-5(9)6(8)7(10)11/h6H,2-4H2,1H3,(H,10,11).
What are the key properties of 2-chloro-3-oxoheptanoic acid?
2-chloro-3-oxoheptanoic acid has a molecular weight of 178.62 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-oxoheptanoic acid is sourced from PubChem (CID 23089387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).