C20H39NO4S — CID 173088949
1-amino-3-oxoicos-11-ene-2-sulfonic acid (PubChem CID 173088949) has the molecular formula C20H39NO4S and a molecular weight of 389.60 g/mol. Its IUPAC name is 1-amino-3-oxoicos-11-ene-2-sulfonic acid.
| Compound Name | 1-amino-3-oxoicos-11-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 173088949 |
| Molecular Formula | C20H39NO4S |
| Molecular Weight | 389.60 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 1-amino-3-oxoicos-11-ene-2-sulfonic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(CN)S(=O)(=O)O |
| InChI | InChI=1S/C20H39NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20(18-21)26(23,24)25/h9-10,20H,2-8,11-18,21H2,1H3,(H,23,24,25) |
| InChIKey | HXHBYHZUBRJGRI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|