C40H77NO6S — CID 175302717
(9Z,28Z)-19-[(dimethylamino)methyl]heptatriaconta-9,28-diene-18,20-dione;sulfuric acid (PubChem CID 175302717) has the molecular formula C40H77NO6S and a molecular weight of 700.12 g/mol. Its IUPAC name is (9Z,28Z)-19-[(dimethylamino)methyl]heptatriaconta-9,28-diene-18,20-dione;sulfuric acid.
| Compound Name | (9Z,28Z)-19-[(dimethylamino)methyl]heptatriaconta-9,28-diene-18,20-dione;sulfuric acid |
|---|---|
| PubChem CID | 175302717 |
| Molecular Formula | C40H77NO6S |
| Molecular Weight | 700.12 g/mol |
| Exact Mass | 699.55 |
| IUPAC Name | (9Z,28Z)-19-[(dimethylamino)methyl]heptatriaconta-9,28-diene-18,20-dione;sulfuric acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CN(C)C)C(=O)CCCCCCC/C=C\CCCCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C40H75NO2.H2O4S/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(42)38(37-41(3)4)40(43)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;1-5(2,3)4/h19-22,38H,5-18,23-37H2,1-4H3;(H2,1,2,3,4)/b21-19-,22-20-; |
| InChIKey | QVYHSWLHRNZURS-JDVCJPALSA-N |
| XLogP | 11.72 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.12 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|