C38H72N2O3 — CID 161286409
(9Z,28Z)-19-[[amino(hydroxy)amino]methyl]heptatriaconta-9,28-diene-18,20-dione (PubChem CID 161286409) has the molecular formula C38H72N2O3 and a molecular weight of 605.01 g/mol. Its IUPAC name is (9Z,28Z)-19-[[amino(hydroxy)amino]methyl]heptatriaconta-9,28-diene-18,20-dione.
| Compound Name | (9Z,28Z)-19-[[amino(hydroxy)amino]methyl]heptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 161286409 |
| Molecular Formula | C38H72N2O3 |
| Molecular Weight | 605.01 g/mol |
| Exact Mass | 604.55 |
| IUPAC Name | (9Z,28Z)-19-[[amino(hydroxy)amino]methyl]heptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CN(N)O)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C38H72N2O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(41)36(35-40(39)43)38(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,36,43H,3-16,21-35,39H2,1-2H3/b19-17-,20-18- |
| InChIKey | PNTVSAXEDQIBNM-CLFAGFIQSA-N |
| XLogP | 11.38 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.01 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|