C40H75NO2 — CID 175606175
(9Z,28Z)-19-(ethylaminomethyl)heptatriaconta-9,28-diene-18,20-dione (PubChem CID 175606175) has the molecular formula C40H75NO2 and a molecular weight of 602.05 g/mol. Its IUPAC name is (9Z,28Z)-19-(ethylaminomethyl)heptatriaconta-9,28-diene-18,20-dione.
| Compound Name | (9Z,28Z)-19-(ethylaminomethyl)heptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 175606175 |
| Molecular Formula | C40H75NO2 |
| Molecular Weight | 602.05 g/mol |
| Exact Mass | 601.58 |
| IUPAC Name | (9Z,28Z)-19-(ethylaminomethyl)heptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CNCC)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C40H75NO2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(42)38(37-41-6-3)40(43)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,38,41H,4-18,23-37H2,1-3H3/b21-19-,22-20- |
| InChIKey | MPIIUNRTDLKCPH-WRBBJXAJSA-N |
| XLogP | 12.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.05 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|