C42H81NO7S — CID 175023291
(9Z,28Z)-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate (PubChem CID 175023291) has the molecular formula C42H81NO7S and a molecular weight of 744.18 g/mol. Its IUPAC name is (9Z,28Z)-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate.
| Compound Name | (9Z,28Z)-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 175023291 |
| Molecular Formula | C42H81NO7S |
| Molecular Weight | 744.18 g/mol |
| Exact Mass | 743.57 |
| IUPAC Name | (9Z,28Z)-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CN(C)CCO)C(=O)CCCCCCC/C=C\CCCCCCCC.COS(=O)(=O)O |
| InChI | InChI=1S/C41H77NO3.CH4O4S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-40(44)39(38-42(3)36-37-43)41(45)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-5-6(2,3)4/h18-21,39,43H,4-17,22-38H2,1-3H3;1H3,(H,2,3,4)/b20-18-,21-19-; |
| InChIKey | GDJUHIMEMGGOHS-YIQDKWKASA-N |
| XLogP | 11.18 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.18 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|