C24H51NO7S — CID 174888113
N-ethoxy-N-methylethanamine;methyl hydrogen sulfate;(Z)-octadec-9-enoic acid (PubChem CID 174888113) has the molecular formula C24H51NO7S and a molecular weight of 497.74 g/mol. Its IUPAC name is N-ethoxy-N-methylethanamine;methyl hydrogen sulfate;(Z)-octadec-9-enoic acid.
| Compound Name | N-ethoxy-N-methylethanamine;methyl hydrogen sulfate;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 174888113 |
| Molecular Formula | C24H51NO7S |
| Molecular Weight | 497.74 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | N-ethoxy-N-methylethanamine;methyl hydrogen sulfate;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.CCON(C)CC.COS(=O)(=O)O |
| InChI | InChI=1S/C18H34O2.C5H13NO.CH4O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-6(3)7-5-2;1-5-6(2,3)4/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-5H2,1-3H3;1H3,(H,2,3,4)/b10-9-;; |
| InChIKey | DIYPNODJDYZKRZ-XXAVUKJNSA-N |
| XLogP | 6.43 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|