C42H82N2O7S — CID 173200733
(9Z,28Z)-19-amino-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate (PubChem CID 173200733) has the molecular formula C42H82N2O7S and a molecular weight of 759.19 g/mol. Its IUPAC name is (9Z,28Z)-19-amino-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate.
| Compound Name | (9Z,28Z)-19-amino-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 173200733 |
| Molecular Formula | C42H82N2O7S |
| Molecular Weight | 759.19 g/mol |
| Exact Mass | 758.58 |
| IUPAC Name | (9Z,28Z)-19-amino-19-[[2-hydroxyethyl(methyl)amino]methyl]heptatriaconta-9,28-diene-18,20-dione;methyl hydrogen sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(N)(CN(C)CCO)C(=O)CCCCCCC/C=C\CCCCCCCC.COS(=O)(=O)O |
| InChI | InChI=1S/C41H78N2O3.CH4O4S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-39(45)41(42,38-43(3)36-37-44)40(46)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-5-6(2,3)4/h18-21,44H,4-17,22-38,42H2,1-3H3;1H3,(H,2,3,4)/b20-18-,21-19-; |
| InChIKey | OFFLTNDDHHRKIB-YIQDKWKASA-N |
| XLogP | 10.26 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.19 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|