C38H71NO2 — CID 173351868
19-amino-19-methylheptatriaconta-9,28-diene-18,20-dione (PubChem CID 173351868) has the molecular formula C38H71NO2 and a molecular weight of 573.99 g/mol. Its IUPAC name is 19-amino-19-methylheptatriaconta-9,28-diene-18,20-dione.
| Compound Name | 19-amino-19-methylheptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 173351868 |
| Molecular Formula | C38H71NO2 |
| Molecular Weight | 573.99 g/mol |
| Exact Mass | 573.55 |
| IUPAC Name | 19-amino-19-methylheptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(C)(N)C(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C38H71NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36(40)38(3,39)37(41)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21H,4-17,22-35,39H2,1-3H3 |
| InChIKey | ZIZAWDTZQOTAFX-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.99 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|