C21H39NO3 — CID 173291281
2-amino-2-methyl-3-oxoicos-11-enoic acid (PubChem CID 173291281) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is 2-amino-2-methyl-3-oxoicos-11-enoic acid.
| Compound Name | 2-amino-2-methyl-3-oxoicos-11-enoic acid |
|---|---|
| PubChem CID | 173291281 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | 2-amino-2-methyl-3-oxoicos-11-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(C)(N)C(=O)O |
| InChI | InChI=1S/C21H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(23)21(2,22)20(24)25/h10-11H,3-9,12-18,22H2,1-2H3,(H,24,25) |
| InChIKey | VXQQCIIETWDLPQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|