C22H45NO3 — CID 6441126
2-amino-2-methylpropan-1-ol;(Z)-octadec-9-enoic acid (PubChem CID 6441126) has the molecular formula C22H45NO3 and a molecular weight of 371.61 g/mol. Its IUPAC name is 2-amino-2-methylpropan-1-ol;(Z)-octadec-9-enoic acid.
| Compound Name | 2-amino-2-methylpropan-1-ol;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 6441126 |
| Molecular Formula | C22H45NO3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.34 |
| IUPAC Name | 2-amino-2-methylpropan-1-ol;(Z)-octadec-9-enoic acid |
| SMILES | CC(C)(N)CO.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2,5)3-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);6H,3,5H2,1-2H3/b10-9-; |
| InChIKey | WCDXNKJYIXSLTE-KVVVOXFISA-N |
| XLogP | 5.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|