C22H44N2O — CID 175408915
(Z)-4,4-diaminodocos-13-en-5-one (PubChem CID 175408915) has the molecular formula C22H44N2O and a molecular weight of 352.61 g/mol. Its IUPAC name is (Z)-4,4-diaminodocos-13-en-5-one.
| Compound Name | (Z)-4,4-diaminodocos-13-en-5-one |
|---|---|
| PubChem CID | 175408915 |
| Molecular Formula | C22H44N2O |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.35 |
| IUPAC Name | (Z)-4,4-diaminodocos-13-en-5-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(N)(N)CCC |
| InChI | InChI=1S/C22H44N2O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(25)22(23,24)20-4-2/h11-12H,3-10,13-20,23-24H2,1-2H3/b12-11- |
| InChIKey | INZSQUGMXLRHKQ-QXMHVHEDSA-N |
| XLogP | 6.01 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|