C38H72N2O2 — CID 54450542
19-amino-19-(aminomethyl)heptatriaconta-9,28-diene-18,20-dione (PubChem CID 54450542) has the molecular formula C38H72N2O2 and a molecular weight of 589.01 g/mol. Its IUPAC name is 19-amino-19-(aminomethyl)heptatriaconta-9,28-diene-18,20-dione.
| Compound Name | 19-amino-19-(aminomethyl)heptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 54450542 |
| Molecular Formula | C38H72N2O2 |
| Molecular Weight | 589.01 g/mol |
| Exact Mass | 588.56 |
| IUPAC Name | 19-amino-19-(aminomethyl)heptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(N)(CN)C(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C38H72N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36(41)38(40,35-39)37(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-35,39-40H2,1-2H3 |
| InChIKey | WUQYBJLJEDTHSI-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.01 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|