C39H71NO4 — CID 162469658
(Z)-2-amino-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enoic acid (PubChem CID 162469658) has the molecular formula C39H71NO4 and a molecular weight of 618.00 g/mol. Its IUPAC name is (Z)-2-amino-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enoic acid.
| Compound Name | (Z)-2-amino-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enoic acid |
|---|---|
| PubChem CID | 162469658 |
| Molecular Formula | C39H71NO4 |
| Molecular Weight | 618.00 g/mol |
| Exact Mass | 617.54 |
| IUPAC Name | (Z)-2-amino-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CC(N)(C(=O)O)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H71NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36(41)35-39(40,38(43)44)37(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-35,40H2,1-2H3,(H,43,44)/b19-17-,20-18- |
| InChIKey | FBFRHASKNBPUKS-CLFAGFIQSA-N |
| XLogP | 11.37 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.00 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|