C22H46N4O2 — CID 90888522
1,1-diamino-1-(1,1-diaminoethoxy)icos-11-en-3-one (PubChem CID 90888522) has the molecular formula C22H46N4O2 and a molecular weight of 398.64 g/mol. Its IUPAC name is 1,1-diamino-1-(1,1-diaminoethoxy)icos-11-en-3-one.
| Compound Name | 1,1-diamino-1-(1,1-diaminoethoxy)icos-11-en-3-one |
|---|---|
| PubChem CID | 90888522 |
| Molecular Formula | C22H46N4O2 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.36 |
| IUPAC Name | 1,1-diamino-1-(1,1-diaminoethoxy)icos-11-en-3-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)CC(N)(N)OC(C)(N)N |
| InChI | InChI=1S/C22H46N4O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(27)19-22(25,26)28-21(2,23)24/h10-11H,3-9,12-19,23-26H2,1-2H3 |
| InChIKey | JDYHQTRNILBKHW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|