C43H82BrNO3 — CID 175434740
(9Z,29Z)-19-(2-amino-4-hydroxybutan-2-yl)-19-methyloctatriaconta-9,29-diene-18,21-dione;hydrobromide (PubChem CID 175434740) has the molecular formula C43H82BrNO3 and a molecular weight of 741.04 g/mol. Its IUPAC name is (9Z,29Z)-19-(2-amino-4-hydroxybutan-2-yl)-19-methyloctatriaconta-9,29-diene-18,21-dione;hydrobromide.
| Compound Name | (9Z,29Z)-19-(2-amino-4-hydroxybutan-2-yl)-19-methyloctatriaconta-9,29-diene-18,21-dione;hydrobromide |
|---|---|
| PubChem CID | 175434740 |
| Molecular Formula | C43H82BrNO3 |
| Molecular Weight | 741.04 g/mol |
| Exact Mass | 739.55 |
| IUPAC Name | (9Z,29Z)-19-(2-amino-4-hydroxybutan-2-yl)-19-methyloctatriaconta-9,29-diene-18,21-dione;hydrobromide |
| SMILES | Br.CCCCCCCC/C=C\CCCCCCCC(=O)CC(C)(C(=O)CCCCCCC/C=C\CCCCCCCC)C(C)(N)CCO |
| InChI | InChI=1S/C43H81NO3.BrH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(46)39-42(3,43(4,44)37-38-45)41(47)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h19-22,45H,5-18,23-39,44H2,1-4H3;1H/b21-19-,22-20-; |
| InChIKey | BYYCSZLPYGKPMF-JDVCJPALSA-N |
| XLogP | 13.27 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.04 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|