C41H78N2O2 — CID 174702931
(9Z,30Z)-19,19-bis(aminomethyl)nonatriaconta-9,30-diene-18,22-dione (PubChem CID 174702931) has the molecular formula C41H78N2O2 and a molecular weight of 631.09 g/mol. Its IUPAC name is (9Z,30Z)-19,19-bis(aminomethyl)nonatriaconta-9,30-diene-18,22-dione.
| Compound Name | (9Z,30Z)-19,19-bis(aminomethyl)nonatriaconta-9,30-diene-18,22-dione |
|---|---|
| PubChem CID | 174702931 |
| Molecular Formula | C41H78N2O2 |
| Molecular Weight | 631.09 g/mol |
| Exact Mass | 630.61 |
| IUPAC Name | (9Z,30Z)-19,19-bis(aminomethyl)nonatriaconta-9,30-diene-18,22-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CCC(CN)(CN)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C41H78N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(44)35-36-41(37-42,38-43)40(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-38,42-43H2,1-2H3/b19-17-,20-18- |
| InChIKey | ADWBDMSCQGBVIC-CLFAGFIQSA-N |
| XLogP | 11.88 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.09 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|